DIBROMOBIMANE
Catalog No: FT-0624667
CAS No: 68654-25-1
- Chemical Name: DIBROMOBIMANE
- Molecular Formula: C10H10Br2N2O2
- Molecular Weight: 350.01
- InChI Key: OSIYFMVMZXJKSP-UHFFFAOYSA-N
- InChI: InChI=1S/C10H10Br2N2O2/c1-5-7(3-11)13-8(4-12)6(2)10(16)14(13)9(5)15/h3-4H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 68654-25-1 |
| Flash_Point: | 178.6ºC |
| Product_Name: | dibromobimane |
| Bolling_Point: | 371.8ºC at 760mmHg |
| FW: | 350.00700 |
| Melting_Point: | 170-172ºC(lit.) |
| MF: | C10H10Br2N2O2 |
| Density: | 1.98g/cm3 |
| Melting_Point: | 170-172ºC(lit.) |
|---|---|
| Refractive_Index: | 1.677 |
| MF: | C10H10Br2N2O2 |
| Flash_Point: | 178.6ºC |
| LogP: | 1.60360 |
| FW: | 350.00700 |
| Density: | 1.98g/cm3 |
| PSA: | 42.96000 |
| Bolling_Point: | 371.8ºC at 760mmHg |
| Exact_Mass: | 347.91100 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)