Dicyclohexylchlorophosphine
Catalog No: FT-0623639
CAS No: 16523-54-9
- Chemical Name: Dicyclohexylchlorophosphine
- Molecular Formula: C12H22ClP
- Molecular Weight: 232.73
- InChI Key: AKJFBIZAEPTXIL-UHFFFAOYSA-N
- InChI: InChI=1S/C12H22ClP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12H,1-10H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 232.730 |
| Density: | 1.054 g/mL at 25 °C(lit.) |
| CAS: | 16523-54-9 |
| Bolling_Point: | 297.5±7.0 °C at 760 mmHg |
| Product_Name: | Dicyclohexylphosphinous chloride |
| Melting_Point: | N/A |
| Flash_Point: | 133.7±18.2 °C |
| MF: | C12H22ClP |
| Flash_Point: | 133.7±18.2 °C |
|---|---|
| Refractive_Index: | n20/D 1.533(lit.) |
| FW: | 232.730 |
| Density: | 1.054 g/mL at 25 °C(lit.) |
| Bolling_Point: | 297.5±7.0 °C at 760 mmHg |
| Computational_Chemistry: | ['1. XlogP :43 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :0 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :N/A ', '6. TPSA 0 ', '7. Heavy Atom Count :14 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :142 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| LogP: | 5.95 |
| Water_Solubility: | reacts violently |
| PSA: | 13.59000 |
| MF: | C12H22ClP |
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)1054g/mLat 25°C(lit)3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)Unknow ', '5. Boiling point(ºC,Atmospheric pressure)165°C12mm Hg(lit)6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive indexn 20/D 1533(lit)8. Flash point(ºC)>230°F9. Specific rotation(º)Unknow ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility reacts violently'] |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 232.114761 |
| Hazard_Codes: | C:Corrosive; |
|---|---|
| Symbol: | Danger |
| Packing_Group: | II |
| Hazard_Class: | 8 |
| Supplementary_Hazard_Statement: | Reacts violently with water. |
| Warning_Statement: | P280-P305 + P351 + P338-P310 |
| HS_Code: | 2903890090 |
| Personal_Protective_Equipment: | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Risk_Statements(EU): | R14;R34 |
| Safety_Statements: | S26-S27-S36/37/39-S45-S8 |
| RIDADR: | UN 3265 8/PG 2 |
| WGK_Germany: | 3 |