7-FLUORO-2-METHYL-QUINOLIN-4-OL
Catalog No: FT-0621410
CAS No: 18529-03-8
- Chemical Name: 7-FLUORO-2-METHYL-QUINOLIN-4-OL
- Molecular Formula: C10H8FNO
- Molecular Weight: 177.17
- InChI Key: DGZLIRLGDGAYDG-UHFFFAOYSA-N
- InChI: InChI=1S/C10H8FNO/c1-6-4-10(13)8-3-2-7(11)5-9(8)12-6/h2-5H,1H3,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 177.175 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 18529-03-8 |
| Bolling_Point: | 272.0±40.0 °C at 760 mmHg |
| Product_Name: | 7-Fluoro-2-methylquinolin-4-ol |
| Melting_Point: | N/A |
| Flash_Point: | 118.3±27.3 °C |
| MF: | C10H8FNO |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 3.58 |
| Flash_Point: | 118.3±27.3 °C |
| Refractive_Index: | 1.554 |
| FW: | 177.175 |
| PSA: | 33.12000 |
| MF: | C10H8FNO |
| Bolling_Point: | 272.0±40.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 177.058990 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933499090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)