6,7-DIMETHOXY-3',4',5-TRIHYDROXYFLAVONE
Catalog No: FT-0620861
CAS No: 34334-69-5
- Chemical Name: 6,7-DIMETHOXY-3',4',5-TRIHYDROXYFLAVONE
- Molecular Formula: C17H14O7
- Molecular Weight: 330.29
- InChI Key: IMEYGBIXGJLUIS-UHFFFAOYSA-N
- InChI: InChI=1S/C17H14O7/c1-22-14-7-13-15(16(21)17(14)23-2)11(20)6-12(24-13)8-3-4-9(18)10(19)5-8/h3-7,18-19,21H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 34334-69-5 |
| Flash_Point: | 230.8±25.0 °C |
| Product_Name: | Cirsiliol |
| Bolling_Point: | 616.1±55.0 °C at 760 mmHg |
| FW: | 330.289 |
| Melting_Point: | N/A |
| MF: | C17H14O7 |
| Density: | 1.5±0.1 g/cm3 |
| Refractive_Index: | 1.671 |
|---|---|
| Vapor_Pressure: | 0.0±1.8 mmHg at 25°C |
| MF: | C17H14O7 |
| Flash_Point: | 230.8±25.0 °C |
| LogP: | 2.27 |
| FW: | 330.289 |
| Density: | 1.5±0.1 g/cm3 |
| PSA: | 109.36000 |
| Bolling_Point: | 616.1±55.0 °C at 760 mmHg |
| Exact_Mass: | 330.073944 |
| Symbol: | GHS07 |
|---|---|
| RTECS: | DJ3011100 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2914509090 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)