4-Amino-1-methyl-3-propyl-5-pyrazolecarboxamide
Catalog No: FT-0617433
CAS No: 139756-02-8
- Chemical Name: 4-Amino-1-methyl-3-propyl-5-pyrazolecarboxamide
- Molecular Formula: C8H14N4O
- Molecular Weight: 182.22
- InChI Key: PZMXDLWWQHYXGY-UHFFFAOYSA-N
- InChI: InChI=1S/C8H14N4O/c1-3-4-5-6(9)7(8(10)13)12(2)11-5/h3-4,9H2,1-2H3,(H2,10,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 182.223 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 139756-02-8 |
| Bolling_Point: | 325.9±42.0 °C at 760 mmHg |
| Product_Name: | 4-Amino-1-methyl-3-N-propyprzole-5-carboxamide |
| Melting_Point: | 98-101ºC |
| Flash_Point: | 150.9±27.9 °C |
| MF: | C8H14N4O |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 0.17 |
| Flash_Point: | 150.9±27.9 °C |
| Melting_Point: | 98-101ºC |
| FW: | 182.223 |
| PSA: | 86.93000 |
| Exact_Mass: | 182.116760 |
| MF: | C8H14N4O |
| Bolling_Point: | 325.9±42.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Refractive_Index: | 1.619 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi:Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26-S36 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933199090 |
| WGK_Germany: | 3 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)