4-(1H-INDOL-3-YL)BUTAN-2-ONE
Catalog No: FT-0616473
CAS No: 5541-89-9
- Chemical Name: 4-(1H-INDOL-3-YL)BUTAN-2-ONE
- Molecular Formula: C12H13NO
- Molecular Weight: 187.24
- InChI Key: ZJCUUXGLZWBCIL-UHFFFAOYSA-N
- InChI: InChI=1S/C12H13NO/c1-9(14)6-7-10-8-13-12-5-3-2-4-11(10)12/h2-5,8,13H,6-7H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3-(3-Oxobutyl)-1H-indole |
|---|---|
| Bolling_Point: | 356.1ºC at 760 mmHg |
| Density: | 1.136 g/cm3 |
| MF: | C12H13NO |
| CAS: | 5541-89-9 |
| Melting_Point: | 94ºC |
| Flash_Point: | 177ºC |
| FW: | 187.23800 |
| Exact_Mass: | 187.10000 |
|---|---|
| Refractive_Index: | 1.613 |
| LogP: | 2.68950 |
| Bolling_Point: | 356.1ºC at 760 mmHg |
| Density: | 1.136 g/cm3 |
| MF: | C12H13NO |
| PSA: | 32.86000 |
| FW: | 187.23800 |
| Flash_Point: | 177ºC |
| Melting_Point: | 94ºC |
| Hazard_Codes: | Xi |
|---|---|
| Safety_Statements: | S24/25 |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)