3-(2-THIENYL)ACRYLIC ACID
Catalog No: FT-0613593
CAS No: 15690-25-2
- Chemical Name: 3-(2-THIENYL)ACRYLIC ACID
- Molecular Formula: C7H6O2S
- Molecular Weight: 154.19
- InChI Key: KKMZQOIASVGJQE-ONEGZZNKSA-N
- InChI: InChI=1S/C7H6O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-5H,(H,8,9)/b4-3+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3-(2-THIENYL)ACRYLIC ACID |
|---|---|
| Flash_Point: | 134.6ºC |
| Melting_Point: | 145-148ºC |
| FW: | 154.18600 |
| Density: | N/A |
| CAS: | 15690-25-2 |
| Bolling_Point: | 298.9ºC at 760 mmHg |
| MF: | C7H6O2S |
| LogP: | 1.84590 |
|---|---|
| Flash_Point: | 134.6ºC |
| FW: | 154.18600 |
| Bolling_Point: | 298.9ºC at 760 mmHg |
| Melting_Point: | 145-148ºC |
| PSA: | 65.54000 |
| MF: | C7H6O2S |
| More_Info: | ['1. Appearance 茶色粉末。 ', '2. Density(g/mL,25/4℃)Unknow ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)145-148 ', '5. Boiling point(ºC,Atmospheric pressure)Unknow ', '<SPAN style="FONT-SIZE: 9'] |
| Vapor_Pressure: | 0.000551mmHg at 25°C |
| Exact_Mass: | 154.00900 |
| Hazard_Codes: | Xi:Irritant; |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26-S37/39 |