Hexyl 2-methylbutyrate
Catalog No: FT-0613028
CAS No: 10032-15-2
- Chemical Name: Hexyl 2-methylbutyrate
- Molecular Formula: C11H22O2
- Molecular Weight: 186.29
- InChI Key: YUECNVSODFDKOQ-UHFFFAOYSA-N
- InChI: InChI=1S/C11H22O2/c1-4-6-7-8-9-13-11(12)10(3)5-2/h10H,4-9H2,1-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS09 |
|---|---|
| CAS: | 10032-15-2 |
| Flash_Point: | 83.9±0.0 °C |
| Product_Name: | UNII:UI17LL5Q4P |
| Bolling_Point: | 214.2±8.0 °C at 760 mmHg |
| FW: | 186.291 |
| Melting_Point: | N/A |
| MF: | C11H22O2 |
| Density: | 0.9±0.1 g/cm3 |
| Refractive_Index: | 1.425 |
|---|---|
| Vapor_Pressure: | 0.2±0.4 mmHg at 25°C |
| MF: | C11H22O2 |
| Flash_Point: | 83.9±0.0 °C |
| LogP: | 4.24 |
| FW: | 186.291 |
| Density: | 0.9±0.1 g/cm3 |
| PSA: | 26.30000 |
| Bolling_Point: | 214.2±8.0 °C at 760 mmHg |
| Exact_Mass: | 186.161987 |
| Risk_Statements(EU): | R51/53 |
|---|---|
| HS_Code: | 2915900090 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
| RTECS: | ET5675000 |
| RIDADR: | UN 3077 9/PG 3 |
| Hazard_Codes: | N: Dangerous for the environment; |
| Warning_Statement: | P273 |
| Safety_Statements: | H411 |
| Symbol: | GHS09 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)