2H-CHROMENE-3-CARBONYL CHLORIDE
Catalog No: FT-0612477
CAS No: 41873-72-7
- Chemical Name: 2H-CHROMENE-3-CARBONYL CHLORIDE
- Molecular Formula: C10H7ClO2
- Molecular Weight: 194.61
- InChI Key: RTKZPVOAMHWVCN-UHFFFAOYSA-N
- InChI: InChI=1S/C10H7ClO2/c11-10(12)8-5-7-3-1-2-4-9(7)13-6-8/h1-5H,6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2h-chromene-3-carbonyl chloride |
|---|---|
| Flash_Point: | 115.1ºC |
| Melting_Point: | 67ºC |
| FW: | 194.61400 |
| Density: | 1.344g/cm3 |
| CAS: | 41873-72-7 |
| Bolling_Point: | 309.6ºC at 760mmHg |
| MF: | C10H7ClO2 |
| Density: | 1.344g/cm3 |
|---|---|
| LogP: | 2.22780 |
| Flash_Point: | 115.1ºC |
| Melting_Point: | 67ºC |
| FW: | 194.61400 |
| PSA: | 26.30000 |
| Exact_Mass: | 194.01300 |
| MF: | C10H7ClO2 |
| Bolling_Point: | 309.6ºC at 760mmHg |
| Refractive_Index: | 1.593 |
| Hazard_Codes: | C:Corrosive |
|---|---|
| Risk_Statements(EU): | R20/21/22;R34 |
| HS_Code: | 2916190090 |
| Safety_Statements: | S26-S36/37/39-S45 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)