5-Fluoro-2-nitroanisole
Catalog No: FT-0612040
CAS No: 448-19-1
- Chemical Name: 5-Fluoro-2-nitroanisole
- Molecular Formula: C7H6FNO3
- Molecular Weight: 171.13
- InChI Key: WLKUSVNHZXUEFO-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6FNO3/c1-12-7-4-5(8)2-3-6(7)9(10)11/h2-4H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 171.126 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 448-19-1 |
| Bolling_Point: | 245.8±20.0 °C at 760 mmHg |
| Product_Name: | 5-Fluoro-2-nitroanisole |
| Melting_Point: | 49-51ºC |
| Flash_Point: | 102.5±21.8 °C |
| MF: | C7H6FNO3 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 1.63 |
| Flash_Point: | 102.5±21.8 °C |
| Melting_Point: | 49-51ºC |
| FW: | 171.126 |
| PSA: | 55.05000 |
| Exact_Mass: | 171.033173 |
| MF: | C7H6FNO3 |
| Bolling_Point: | 245.8±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Refractive_Index: | 1.522 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2909309090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)