2-(STYRYLTHIO)ACETIC ACID
Catalog No: FT-0608923
CAS No: 13435-97-7
- Chemical Name: 2-(STYRYLTHIO)ACETIC ACID
- Molecular Formula: C10H10O2S
- Molecular Weight: 194.25
- InChI Key: IUEVBKDVPSQVLM-VOTSOKGWSA-N
- InChI: InChI=1S/C10H10O2S/c11-10(12)8-13-7-6-9-4-2-1-3-5-9/h1-7H,8H2,(H,11,12)/b7-6+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-(styrylthio)acetic acid |
|---|---|
| Flash_Point: | 178.4ºC |
| Melting_Point: | N/A |
| FW: | 194.25000 |
| Density: | 1.249g/cm3 |
| CAS: | 13435-97-7 |
| Bolling_Point: | 371.4ºC at 760mmHg |
| MF: | C10H10O2S |
| Density: | 1.249g/cm3 |
|---|---|
| LogP: | 2.47510 |
| Flash_Point: | 178.4ºC |
| Refractive_Index: | 1.644 |
| FW: | 194.25000 |
| PSA: | 62.60000 |
| MF: | C10H10O2S |
| Bolling_Point: | 371.4ºC at 760mmHg |
| Vapor_Pressure: | 3.58E-06mmHg at 25°C |
| Exact_Mass: | 194.04000 |
| HS_Code: | 2930909090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)