2-(2,5-DIMETHYL-1H-PYRROL-1-YL)PHENYLAMINE
Catalog No: FT-0608408
CAS No: 2405-01-8
- Chemical Name: 2-(2,5-DIMETHYL-1H-PYRROL-1-YL)PHENYLAMINE
- Molecular Formula: C12H14N2
- Molecular Weight: 186.25
- InChI Key: ZCCGWYQXOIOJRO-UHFFFAOYSA-N
- InChI: InChI=1S/C12H14N2/c1-9-7-8-10(2)14(9)12-6-4-3-5-11(12)13/h3-8H,13H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 79-81ºC |
|---|---|
| CAS: | 2405-01-8 |
| MF: | C12H14N2 |
| Flash_Point: | 156.8ºC |
| Product_Name: | 2-(2,5-Dimethyl-1H-pyrrol-1-yl)phenylamine |
| Density: | 1.06g/cm3 |
| FW: | 186.25300 |
| Bolling_Point: | 335.6ºC at 760mmHg |
| Melting_Point: | 79-81ºC |
|---|---|
| Refractive_Index: | 1.581 |
| Vapor_Pressure: | 0.000118mmHg at 25°C |
| MF: | C12H14N2 |
| Flash_Point: | 156.8ºC |
| LogP: | 3.25750 |
| FW: | 186.25300 |
| Density: | 1.06g/cm3 |
| PSA: | 30.95000 |
| Bolling_Point: | 335.6ºC at 760mmHg |
| Exact_Mass: | 186.11600 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| HS_Code: | 2933990090 |