2-(2,4-DIFLUOROPHENYL)THIAZOLE-4-CARBOXAMIDE
Catalog No: FT-0608404
CAS No: 175276-97-8
- Chemical Name: 2-(2,4-DIFLUOROPHENYL)THIAZOLE-4-CARBOXAMIDE
- Molecular Formula: C10H6F2N2OS
- Molecular Weight: 240.23
- InChI Key: NHQYYXGZHSVWOK-UHFFFAOYSA-N
- InChI: InChI=1S/C10H6F2N2OS/c11-5-1-2-6(7(12)3-5)10-14-8(4-16-10)9(13)15/h1-4H,(H2,13,15)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-(2,4-difluorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| Flash_Point: | N/A |
| Melting_Point: | 239-241℃ |
| FW: | 240.22900 |
| Density: | N/A |
| CAS: | 175276-97-8 |
| Bolling_Point: | N/A |
| MF: | C10H6F2N2OS |
| LogP: | 2.88750 |
|---|---|
| Melting_Point: | 239-241℃ |
| FW: | 240.22900 |
| PSA: | 84.22000 |
| MF: | C10H6F2N2OS |
| Exact_Mass: | 240.01700 |