2-(2,3-DIMETHYLPHENOXY)-3-NITROPYRIDINE
Catalog No: FT-0608394
CAS No: 76893-55-5
- Chemical Name: 2-(2,3-DIMETHYLPHENOXY)-3-NITROPYRIDINE
- Molecular Formula: C13H12N2O3
- Molecular Weight: 244.25
- InChI Key: RNOWNESUZZSGDB-UHFFFAOYSA-N
- InChI: InChI=1S/C13H12N2O3/c1-9-5-3-7-12(10(9)2)18-13-11(15(16)17)6-4-8-14-13/h3-8H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 244.24600 |
|---|---|
| CAS: | 76893-55-5 |
| Melting_Point: | 210ºC |
| Bolling_Point: | 354.1ºC at 760 mmHg |
| MF: | C13H12N2O3 |
| Product_Name: | 2-(2,3-dimethylphenoxy)-3-nitropyridine |
| Flash_Point: | 167.9ºC |
| Density: | 1.235g/cm3 |
| FW: | 244.24600 |
|---|---|
| MF: | C13H12N2O3 |
| Computational_Chemistry: | ['1. XlogP :33 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :4 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :N/A ', '6. TPSA :679 ', '7. Heavy Atom Count :18 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :293 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 210ºC |
| LogP: | 3.92210 |
| PSA: | 67.94000 |
| Refractive_Index: | 1.593 |
| Bolling_Point: | 354.1ºC at 760 mmHg |
| Flash_Point: | 167.9ºC |
| Exact_Mass: | 244.08500 |
| Density: | 1.235g/cm3 |
| HS_Code: | 2933399090 |
|---|---|
| Safety_Statements: | S24/25 |