1-BENZYL-2-(CHLOROMETHYL)-1H-IMIDAZOLE HCL
Catalog No: FT-0607389
CAS No: 19276-03-0
- Chemical Name: 1-BENZYL-2-(CHLOROMETHYL)-1H-IMIDAZOLE HCL
- Molecular Formula: C11H12Cl2N2
- Molecular Weight: 243.13
- InChI Key: IOOCHXMDSFPOGL-UHFFFAOYSA-N
- InChI: InChI=1S/C11H11ClN2.ClH/c12-8-11-13-6-7-14(11)9-10-4-2-1-3-5-10;/h1-7H,8-9H2;1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 186ºC |
|---|---|
| CAS: | 19276-03-0 |
| MF: | C11H12Cl2N2 |
| Flash_Point: | 155.5ºC |
| Product_Name: | 1-Benzyl-2-(chloromethyl)-1H -imidazole hydrochloride |
| Density: | N/A |
| FW: | 243.13200 |
| Bolling_Point: | 333.4ºC at 760mmHg |
| Melting_Point: | 186ºC |
|---|---|
| Vapor_Pressure: | 0.000265mmHg at 25°C |
| MF: | C11H12Cl2N2 |
| Flash_Point: | 155.5ºC |
| LogP: | 3.47220 |
| Bolling_Point: | 333.4ºC at 760mmHg |
| FW: | 243.13200 |
| PSA: | 17.82000 |
| Exact_Mass: | 242.03800 |
| Safety_Statements: | 26-36/37/39 |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2933290090 |
| Risk_Statements(EU): | R36/37/38 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)