1-[(Benzyloxy)carbonyl]piperidine-4-carboxylic acid
Catalog No: FT-0607081
CAS No: 10314-98-4
- Chemical Name: 1-[(Benzyloxy)carbonyl]piperidine-4-carboxylic acid
- Molecular Formula: C14H17NO4
- Molecular Weight: 263.29
- InChI Key: URTPNQRAHXRPMP-UHFFFAOYSA-N
- InChI: InChI=1S/C14H17NO4/c16-13(17)12-6-8-15(9-7-12)14(18)19-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,16,17)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | N-Cbz-4-Piperidinecarboxylic acid |
|---|---|
| Flash_Point: | 222.3±28.7 °C |
| Melting_Point: | 78ºC |
| FW: | 263.289 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 10314-98-4 |
| Bolling_Point: | 443.9±45.0 °C at 760 mmHg |
| MF: | C14H17NO4 |
| LogP: | 1.66 |
|---|---|
| Flash_Point: | 222.3±28.7 °C |
| Refractive_Index: | 1.569 |
| FW: | 263.289 |
| Bolling_Point: | 443.9±45.0 °C at 760 mmHg |
| Density: | 1.3±0.1 g/cm3 |
| Melting_Point: | 78ºC |
| PSA: | 66.84000 |
| Exact_Mass: | 263.115753 |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| MF: | C14H17NO4 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2933399090 |
| Safety_Statements: | 26-36/37/39-37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)