1,3-DIISOPROPENYLBENZENE
Catalog No: FT-0606673
CAS No: 3748-13-8
- Chemical Name: 1,3-DIISOPROPENYLBENZENE
- Molecular Formula: C12H14
- Molecular Weight: 158.24
- InChI Key: IBVPVTPPYGGAEL-UHFFFAOYSA-N
- InChI: InChI=1S/C12H14/c1-9(2)11-6-5-7-12(8-11)10(3)4/h5-8H,1,3H2,2,4H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| CAS: | 3748-13-8 |
| MF: | C12H14 |
| Flash_Point: | 91.1±0.0 °C |
| Product_Name: | 1,3-diisopropenylbenzene |
| Density: | 0.9±0.1 g/cm3 |
| FW: | 158.240 |
| Bolling_Point: | 231.0±0.0 °C at 760 mmHg |
| Refractive_Index: | 1.516 |
|---|---|
| Vapor_Pressure: | 0.1±0.2 mmHg at 25°C |
| Flash_Point: | 91.1±0.0 °C |
| LogP: | 4.29 |
| Bolling_Point: | 231.0±0.0 °C at 760 mmHg |
| FW: | 158.240 |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :0 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :N/A ', '6. TPSA 0 ', '7. Heavy Atom Count :12 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :168 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| MF: | C12H14 |
| Exact_Mass: | 158.109543 |
| Density: | 0.9±0.1 g/cm3 |
| Risk_Statements(EU): | 36/37/38-50/53 |
|---|---|
| WGK_Germany: | 2 |
| RTECS: | CY8535000 |
| RIDADR: | UN 3082 9/PG 3 |
| Hazard_Codes: | Xi: Irritant;N: Dangerous for the environment; |
| HS_Code: | 2902909090 |
| Safety_Statements: | S26-S61-S60 |