1-(3-Bromophenyl)-1H-pyrrole
Catalog No: FT-0605606
CAS No: 107302-22-7
- Chemical Name: 1-(3-Bromophenyl)-1H-pyrrole
- Molecular Formula: C10H8BrN
- Molecular Weight: 222.08
- InChI Key: LEUXOIBRUWVBGM-UHFFFAOYSA-N
- InChI: InChI=1S/C10H8BrN/c11-9-4-3-5-10(8-9)12-6-1-2-7-12/h1-8H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 63-64ºC |
|---|---|
| CAS: | 107302-22-7 |
| MF: | C10H8BrN |
| Flash_Point: | 132.2ºC |
| Product_Name: | 1-(3-Bromophenyl)-1H-pyrrole |
| Density: | 1.38g/cm3 |
| FW: | 222.08100 |
| Bolling_Point: | 294.9ºC at 760mmHg |
| Melting_Point: | 63-64ºC |
|---|---|
| Refractive_Index: | 1.605 |
| Vapor_Pressure: | 0.00277mmHg at 25°C |
| MF: | C10H8BrN |
| Flash_Point: | 132.2ºC |
| LogP: | 3.23980 |
| FW: | 222.08100 |
| Density: | 1.38g/cm3 |
| PSA: | 4.93000 |
| Bolling_Point: | 294.9ºC at 760mmHg |
| Exact_Mass: | 220.98400 |
| Safety_Statements: | 26-37/39 |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2933990090 |
| Risk_Statements(EU): | 36/37/38 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)