1-(2'-FLUORO[1,1'-BIPHENYL]-4-YL)PROPAN-1-OL
Catalog No: FT-0605535
CAS No: 64820-95-7
- Chemical Name: 1-(2'-FLUORO[1,1'-BIPHENYL]-4-YL)PROPAN-1-OL
- Molecular Formula: C15H15FO
- Molecular Weight: 230.28
- InChI Key: QCPOHBUIIOWWEC-UHFFFAOYSA-N
- InChI: InChI=1S/C15H15FO/c1-2-15(17)12-9-7-11(8-10-12)13-5-3-4-6-14(13)16/h3-10,15,17H,2H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-[4-(2-fluorophenyl)phenyl]propan-1-ol |
|---|---|
| Flash_Point: | 197.9ºC |
| Melting_Point: | 55ºC |
| FW: | 230.27700 |
| Density: | 1.115 g/cm3 |
| CAS: | 64820-95-7 |
| Bolling_Point: | 347.8ºC at 760 mmHg |
| MF: | C15H15FO |
| Density: | 1.115 g/cm3 |
|---|---|
| LogP: | 3.93610 |
| Flash_Point: | 197.9ºC |
| Melting_Point: | 55ºC |
| FW: | 230.27700 |
| PSA: | 20.23000 |
| Exact_Mass: | 230.11100 |
| MF: | C15H15FO |
| Bolling_Point: | 347.8ºC at 760 mmHg |
| Refractive_Index: | 1.557 |
| Hazard_Codes: | Xi:Irritant; |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2906299090 |
| Safety_Statements: | 26-36/37/39 |