(S)-(+)-Phenylsuccinic acid
Catalog No: FT-0605277
CAS No: 4036-30-0
- Chemical Name: (S)-(+)-Phenylsuccinic acid
- Molecular Formula: C10H10O4
- Molecular Weight: 194.18
- InChI Key: LVFFZQQWIZURIO-UHFFFAOYSA-N
- InChI: InChI=1S/C10H10O4/c11-9(12)6-8(10(13)14)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,11,12)(H,13,14)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 173-176ºC |
|---|---|
| CAS: | 4036-30-0 |
| MF: | C10H10O4 |
| Flash_Point: | 154.2±18.8 °C |
| Product_Name: | (S)-(+)-Phenylsuccinic Acid |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 194.184 |
| Bolling_Point: | 307.8±22.0 °C at 760 mmHg |
| Refractive_Index: | 1.578 |
|---|---|
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Flash_Point: | 154.2±18.8 °C |
| LogP: | 1.22 |
| Bolling_Point: | 307.8±22.0 °C at 760 mmHg |
| FW: | 194.184 |
| PSA: | 74.60000 |
| Melting_Point: | 173-176ºC |
| MF: | C10H10O4 |
| Exact_Mass: | 194.057907 |
| Density: | 1.3±0.1 g/cm3 |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi:Irritant; |
| HS_Code: | 2917399090 |
| Safety_Statements: | S26-S37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)