(R)-(-)-MEPHENYTOIN
Catalog No: FT-0605165
CAS No: 71140-51-7
- Chemical Name: (R)-(-)-MEPHENYTOIN
- Molecular Formula: C12H14N2O2
- Molecular Weight: 218.25
- InChI Key: GMHKMTDVRCWUDX-GFCCVEGCSA-N
- InChI: InChI=1S/C12H14N2O2/c1-3-12(9-7-5-4-6-8-9)10(15)14(2)11(16)13-12/h4-8H,3H2,1-2H3,(H,13,16)/t12-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 71140-51-7 |
| Flash_Point: | N/A |
| Product_Name: | (R)-Mephenytoin |
| Bolling_Point: | N/A |
| FW: | 218.25200 |
| Melting_Point: | 137-138ºC |
| MF: | C12H14N2O2 |
| Density: | 1.154g/cm3 |
| Melting_Point: | 137-138ºC |
|---|---|
| Refractive_Index: | 1.541 |
| MF: | C12H14N2O2 |
| Exact_Mass: | 218.10600 |
| LogP: | 1.74020 |
| FW: | 218.25200 |
| Density: | 1.154g/cm3 |
| PSA: | 49.41000 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | 22-36/37/38 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn: Harmful; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)