(R)-1-(3-FLUOROPHENYL)ETHANOL
Catalog No: FT-0605112
CAS No: 126534-33-6
- Chemical Name: (R)-1-(3-FLUOROPHENYL)ETHANOL
- Molecular Formula: C8H9FO
- Molecular Weight: 140.15
- InChI Key: YESOPGLEIJQAEF-ZCFIWIBFSA-N
- InChI: InChI=1S/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3/t6-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | (1R)-1-(3-Fluorophenyl)ethanol |
|---|---|
| Flash_Point: | 90.1±7.2 °C |
| Melting_Point: | N/A |
| FW: | 140.155 |
| Density: | 1.1±0.1 g/cm3 |
| CAS: | 126534-33-6 |
| Bolling_Point: | 196.2±15.0 °C at 760 mmHg |
| MF: | C8H9FO |
| Density: | 1.1±0.1 g/cm3 |
|---|---|
| LogP: | 1.43 |
| Flash_Point: | 90.1±7.2 °C |
| Refractive_Index: | 1.511 |
| FW: | 140.155 |
| PSA: | 20.23000 |
| MF: | C8H9FO |
| Bolling_Point: | 196.2±15.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.3±0.4 mmHg at 25°C |
| Exact_Mass: | 140.063736 |
| Hazard_Codes: | Xi |
|---|