(5-METHYL-2-PHENYL-2H-1,2,3-TRIAZOL-4-YL)METHYLAMINE
Catalog No: FT-0604823
CAS No: 105362-45-6
- Chemical Name: (5-METHYL-2-PHENYL-2H-1,2,3-TRIAZOL-4-YL)METHYLAMINE
- Molecular Formula: C10H12N4
- Molecular Weight: 188.23
- InChI Key: NUKMUNLDDAJKOE-UHFFFAOYSA-N
- InChI: InChI=1S/C10H12N4/c1-8-10(7-11)13-14(12-8)9-5-3-2-4-6-9/h2-6H,7,11H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | (5-methyl-2-phenyltriazol-4-yl)methanamine |
|---|---|
| Flash_Point: | 179ºC |
| Melting_Point: | N/A |
| FW: | 188.22900 |
| Density: | 1.23g/cm3 |
| CAS: | 105362-45-6 |
| Bolling_Point: | 372.4ºC at 760 mmHg |
| MF: | C10H12N4 |
| Density: | 1.23g/cm3 |
|---|---|
| LogP: | 1.73470 |
| Flash_Point: | 179ºC |
| Refractive_Index: | 1.644 |
| FW: | 188.22900 |
| PSA: | 56.73000 |
| MF: | C10H12N4 |
| Bolling_Point: | 372.4ºC at 760 mmHg |
| Vapor_Pressure: | 9.66E-06mmHg at 25°C |
| Exact_Mass: | 188.10600 |
| Hazard_Codes: | C: Corrosive; |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2933990090 |
| Safety_Statements: | 26-36/37/39 |