4-Bromobenzoylacetonitrile
Catalog No: FT-0604206
CAS No: 4592-94-3
- Chemical Name: 4-Bromobenzoylacetonitrile
- Molecular Formula: C9H6BrNO
- Molecular Weight: 224.05
- InChI Key: HSNWUXWZCSDJPL-UHFFFAOYSA-N
- InChI: InChI=1S/C9H6BrNO/c10-8-3-1-7(2-4-8)9(12)5-6-11/h1-4H,5H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3-(4-Bromphenyl)-3-oxopropanonitril |
|---|---|
| Bolling_Point: | 370.0±27.0 °C at 760 mmHg |
| MF: | C9H6BrNO |
| Symbol: | GHS07 |
| Melting_Point: | 161-163ºC |
| CAS: | 4592-94-3 |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 224.054 |
| Flash_Point: | 177.6±23.7 °C |
| MF: | C9H6BrNO |
|---|---|
| Bolling_Point: | 370.0±27.0 °C at 760 mmHg |
| Exact_Mass: | 222.963272 |
| Melting_Point: | 161-163ºC |
| Refractive_Index: | 1.574 |
| PSA: | 40.86000 |
| Flash_Point: | 177.6±23.7 °C |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 224.054 |
| LogP: | 1.74 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Safety_Statements: | H315-H319-H335 |
| HS_Code: | 2926909090 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Symbol: | GHS07 |
| Hazard_Codes: | Xi: Irritant; |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)