Anagrelide
Catalog No: FT-0602855
CAS No: 58579-51-4
- Chemical Name: Anagrelide
- Molecular Formula: C10H8Cl3N3O
- Molecular Weight: 292.5
- InChI Key: TVWRQCIPWUCNMI-UHFFFAOYSA-N
- InChI: InChI=1S/C10H7Cl2N3O.ClH/c11-6-1-2-7-5(9(6)12)3-15-4-8(16)14-10(15)13-7;/h1-2H,3-4H2,(H,13,14,16);1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 376.5ºC at 760 mmHg |
|---|---|
| CAS: | 58579-51-4 |
| MF: | C10H8Cl3N3O |
| Melting_Point: | >280ºC |
| Symbol: | Warning |
| Density: | 1.77g/cm3 |
| FW: | 292.549 |
| Product_Name: | Anagrelide Hydrochloride |
| Flash_Point: | 181.5ºC |
| Bolling_Point: | 376.5ºC at 760 mmHg |
|---|---|
| MF: | C10H8Cl3N3O |
| Density: | 1.77g/cm3 |
| FW: | 292.549 |
| Exact_Mass: | 290.973297 |
| PSA: | 44.70000 |
| LogP: | 2.43060 |
| Flash_Point: | 181.5ºC |
| Melting_Point: | >280ºC |
| Symbol: | Warning |
|---|---|
| HS_Code: | 2933990090 |
| Safety_Statements: | H302-H315-H319-H335 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)