4-Chloro-3-hydroxypyridine
Catalog No: FT-0602255
CAS No: 96630-88-5
- Chemical Name: 4-Chloro-3-hydroxypyridine
- Molecular Formula: C5H4ClNO
- Molecular Weight: 129.54
- InChI Key: GQORRJKLCCMNPX-UHFFFAOYSA-N
- InChI: InChI=1S/C5H4ClNO/c6-4-1-2-7-3-5(4)8/h1-3,8H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 129.544 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 96630-88-5 |
| Bolling_Point: | 298.2±20.0 °C at 760 mmHg |
| Product_Name: | 4-Chloro-3-pyridinol |
| Melting_Point: | N/A |
| Flash_Point: | 134.1±21.8 °C |
| MF: | C5H4ClNO |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 1.05 |
| Flash_Point: | 134.1±21.8 °C |
| Refractive_Index: | 1.584 |
| FW: | 129.544 |
| PSA: | 33.12000 |
| MF: | C5H4ClNO |
| Bolling_Point: | 298.2±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Exact_Mass: | 128.998138 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)