1,3-Dichloroisoquinoline
Catalog No: FT-0602168
CAS No: 7742-73-6
- Chemical Name: 1,3-Dichloroisoquinoline
- Molecular Formula: C9H5Cl2N
- Molecular Weight: 198.05
- InChI Key: BRGZEQXWZWBPJH-UHFFFAOYSA-N
- InChI: InChI=1S/C9H5Cl2N/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-5H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 7742-73-6 |
| Flash_Point: | 182.6±7.9 °C |
| Product_Name: | 1,3-Dichloroisoquinoline |
| Bolling_Point: | 328.7±22.0 °C at 760 mmHg |
| FW: | 198.049 |
| Melting_Point: | 121-122 °C(lit.) |
| MF: | C9H5Cl2N |
| Density: | 1.4±0.1 g/cm3 |
| Refractive_Index: | 1.661 |
|---|---|
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Flash_Point: | 182.6±7.9 °C |
| LogP: | 3.31 |
| Bolling_Point: | 328.7±22.0 °C at 760 mmHg |
| FW: | 198.049 |
| PSA: | 12.89000 |
| Computational_Chemistry: | ['1. XlogP :4 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :N/A ', '6. TPSA 129 ', '7. Heavy Atom Count :12 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :163 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 121-122 °C(lit.) |
| MF: | C9H5Cl2N |
| Exact_Mass: | 196.979904 |
| Molecular_Structure: | ['五分子性质数据'] |
| Density: | 1.4±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2933499090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi:Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)