2-chloro-6-methylpyrazine
Catalog No: FT-0601985
CAS No: 38557-71-0
- Chemical Name: 2-chloro-6-methylpyrazine
- Molecular Formula: C5H5ClN2
- Molecular Weight: 128.56
- InChI Key: CKUVSPQGYLELRG-UHFFFAOYSA-N
- InChI: InChI=1S/C5H5ClN2/c1-4-2-7-3-5(6)8-4/h2-3H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 128.560 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 38557-71-0 |
| Bolling_Point: | 173.6±35.0 °C at 760 mmHg |
| Product_Name: | 2-Chloro-6-methylpyrazine |
| Melting_Point: | 48-52ºC |
| Flash_Point: | 73.3±11.5 °C |
| MF: | C5H5ClN2 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 1.10 |
| Flash_Point: | 73.3±11.5 °C |
| Melting_Point: | 48-52ºC |
| FW: | 128.560 |
| PSA: | 25.78000 |
| Exact_Mass: | 128.014130 |
| MF: | C5H5ClN2 |
| Bolling_Point: | 173.6±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 1.7±0.3 mmHg at 25°C |
| Refractive_Index: | 1.530 |
| Hazard_Codes: | Xn:Harmful; |
|---|---|
| Risk_Statements(EU): | R20/21/22;R36/37/38 |
| Safety_Statements: | S22-S26-S36/37/39 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)