Bicyclo[3.3.1]nonane-2,6-dione
Catalog No: FT-0601198
CAS No: 16473-11-3
- Chemical Name: Bicyclo[3.3.1]nonane-2,6-dione
- Molecular Formula: C9H12O2
- Molecular Weight: 152.19
- InChI Key: QWNPVTXLBMSEPN-UHFFFAOYSA-N
- InChI: InChI=1S/C9H12O2/c10-8-3-1-6-5-7(8)2-4-9(6)11/h6-7H,1-5H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05 |
|---|---|
| CAS: | 16473-11-3 |
| Flash_Point: | 105.6ºC |
| Product_Name: | Bicyclo[3.3.1]nonane-2,6-dione |
| Bolling_Point: | 283.7ºC at 760 mmHg ,180ºC/20mm |
| FW: | 152.19000 |
| Melting_Point: | 151ºC |
| MF: | C9H12O2 |
| Density: | 1.138 g/cm3 |
| Refractive_Index: | 1.507 |
|---|---|
| Vapor_Pressure: | 0.00311mmHg at 25°C |
| Flash_Point: | 105.6ºC |
| LogP: | 1.33470 |
| Bolling_Point: | 283.7ºC at 760 mmHg ,180ºC/20mm |
| FW: | 152.19000 |
| PSA: | 34.14000 |
| Melting_Point: | 151ºC |
| MF: | C9H12O2 |
| Exact_Mass: | 152.08400 |
| Density: | 1.138 g/cm3 |
| Symbol: | GHS05 |
|---|---|
| Risk_Statements(EU): | R41 |
| HS_Code: | 2914299000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H318 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)