10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine
Catalog No: FT-0600897
CAS No: 3159-07-7
- Chemical Name: 10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine
- Molecular Formula: C13H9NOS
- Molecular Weight: 227.28
- InChI Key: RTERDTBXBYNZIS-UHFFFAOYSA-N
- InChI: InChI=1S/C13H9NOS/c15-13-9-5-1-3-7-11(9)16-12-8-4-2-6-10(12)14-13/h1-8H,(H,14,15)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine |
|---|---|
| Flash_Point: | 140.8±19.6 °C |
| Melting_Point: | 265ºC |
| FW: | 227.282 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 3159-07-7 |
| Bolling_Point: | 309.2±12.0 °C at 760 mmHg |
| MF: | C13H9NOS |
| LogP: | 2.97 |
|---|---|
| Flash_Point: | 140.8±19.6 °C |
| Refractive_Index: | 1.667 |
| FW: | 227.282 |
| Bolling_Point: | 309.2±12.0 °C at 760 mmHg |
| Density: | 1.3±0.1 g/cm3 |
| Melting_Point: | 265ºC |
| PSA: | 54.40000 |
| Exact_Mass: | 227.040482 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| MF: | C13H9NOS |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2934999090 |
| Safety_Statements: | 26-36/37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)