2-Amino-5-(4-fluorophenyl)-1,3,4-thiadiazole
Catalog No: FT-0600225
CAS No: 942-70-1
- Chemical Name: 2-Amino-5-(4-fluorophenyl)-1,3,4-thiadiazole
- Molecular Formula: C8H6FN3S
- Molecular Weight: 195.22
- InChI Key: WRSVCKNLHZWSNJ-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6FN3S/c9-6-3-1-5(2-4-6)7-11-12-8(10)13-7/h1-4H,(H2,10,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 195.21700 |
| Density: | 1.423g/cm3 |
| CAS: | 942-70-1 |
| Bolling_Point: | 351.9ºC at 760mmHg |
| Product_Name: | 5-(4-fluorophenyl)-1,3,4-thiadiazol-2-amine |
| Melting_Point: | 238-243ºC |
| Flash_Point: | 166.6ºC |
| MF: | C8H6FN3S |
| Density: | 1.423g/cm3 |
|---|---|
| LogP: | 2.50760 |
| Flash_Point: | 166.6ºC |
| Melting_Point: | 238-243ºC |
| FW: | 195.21700 |
| PSA: | 80.04000 |
| MF: | C8H6FN3S |
| Bolling_Point: | 351.9ºC at 760mmHg |
| Exact_Mass: | 195.02700 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | 26 |
| Symbol: | Warning |
| Warning_Statement: | P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)