Propynoic acid amide
Catalog No: FT-0600128
CAS No: 7341-96-0
- Chemical Name: Propynoic acid amide
- Molecular Formula: C3H3NO
- Molecular Weight: 69.06
- InChI Key: HCJTYESURSHXNB-UHFFFAOYSA-N
- InChI: InChI=1S/C3H3NO/c1-2-3(4)5/h1H,(H2,4,5)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 134.6±23.0 °C at 760 mmHg |
|---|---|
| CAS: | 7341-96-0 |
| MF: | C3H3NO |
| Melting_Point: | 61-62ºC |
| Symbol: | Warning |
| Density: | 1.1±0.1 g/cm3 |
| FW: | 69.062 |
| Product_Name: | Propiolamide |
| Flash_Point: | 35.2±22.6 °C |
| Bolling_Point: | 134.6±23.0 °C at 760 mmHg |
|---|---|
| LogP: | -0.08 |
| Vapor_Pressure: | 8.0±0.2 mmHg at 25°C |
| Density: | 1.1±0.1 g/cm3 |
| Melting_Point: | 61-62ºC |
| Exact_Mass: | 69.021461 |
| MF: | C3H3NO |
| Refractive_Index: | 1.466 |
| PSA: | 43.09000 |
| Flash_Point: | 35.2±22.6 °C |
| FW: | 69.062 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302-H315-H319-H335 |
| Warning_Statement: | P261-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)