![4-Chloro-1-(2-methylpropyl)-1H-imidazo[4,5-c]quinoline (CAS: 99010-64-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0642385.png "4-Chloro-1-(2-methylpropyl)-1H-imidazo[4,5-c]quinoline chemical structure")
4-Chloro-1-(2-methylpropyl)-1H-imidazo[4,5-c]quinoline
Catalog No: FT-0642385
CAS No: 99010-64-7
- Chemical Name: 4-Chloro-1-(2-methylpropyl)-1H-imidazo[4,5-c]quinoline
- Molecular Formula: C14H14ClN3
- Molecular Weight: 259.73
- InChI Key: RRCWSLBKLVBFQD-UHFFFAOYSA-N
- InChI: InChI=1S/C14H14ClN3/c1-9(2)7-18-8-16-12-13(18)10-5-3-4-6-11(10)17-14(12)15/h3-6,8-9H,7H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4-Chloro-1-isobutyl-1H-imidazo[4,5-c]quinoline |
|---|---|
| Flash_Point: | 212.3±29.6 °C |
| Melting_Point: | 212.3ºC |
| FW: | 259.734 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 99010-64-7 |
| Bolling_Point: | 427.5±48.0 °C at 760 mmHg |
| MF: | C14H14ClN3 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 4.25 |
| Flash_Point: | 212.3±29.6 °C |
| Melting_Point: | 212.3ºC |
| FW: | 259.734 |
| PSA: | 30.71000 |
| Exact_Mass: | 259.087616 |
| MF: | C14H14ClN3 |
| Bolling_Point: | 427.5±48.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Refractive_Index: | 1.658 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| HS_Code: | 2933990090 |
Related Products
1-(tertbutoxycarbonyl)-1,2,3,6-tetrahydropyridin-4-yltrifluoromethanesulfonate
