![{1-[(Methylamino)methyl]cyclopentyl}methanol (CAS: 959238-70-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0679652.webp "{1-[(Methylamino)methyl]cyclopentyl}methanol chemical structure")
{1-[(Methylamino)methyl]cyclopentyl}methanol
Catalog No: FT-0679652
CAS No: 959238-70-1
- Chemical Name: {1-[(Methylamino)methyl]cyclopentyl}methanol
- Molecular Formula: C8H17NO
- Molecular Weight: 143.23 g/mol
- InChI Key: SULZFQBYJXFVTO-UHFFFAOYSA-N
- InChI: InChI=1S/C8H17NO/c1-9-6-8(7-10)4-2-3-5-8/h9-10H,2-7H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 143.22700 |
| Density: | 0.941g/cm3 |
| CAS: | 959238-70-1 |
| Bolling_Point: | 214.7ºC at 760 mmHg |
| Product_Name: | [1-(methylaminomethyl)cyclopentyl]methanol |
| Melting_Point: | N/A |
| Flash_Point: | 71.5ºC |
| MF: | C8H17NO |
| Density: | 0.941g/cm3 |
|---|---|
| LogP: | 1.14940 |
| Flash_Point: | 71.5ºC |
| Refractive_Index: | 1.465 |
| FW: | 143.22700 |
| PSA: | 32.26000 |
| MF: | C8H17NO |
| Bolling_Point: | 214.7ºC at 760 mmHg |
| Exact_Mass: | 143.13100 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2922199090 |
| RIDADR: | NONH for all modes of transport |
Related Products
![5,5'-Diamino-3,3,3',3'-tetramethyl-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-6,6'-diol (CAS: 753437-92-2) - Related Chemical Product](/static/img/prod_pic/FT-0782154.webp "5,5'-Diamino-3,3,3',3'-tetramethyl-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-6,6'-diol chemical structure")
5,5'-Diamino-3,3,3',3'-tetramethyl-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-6,6'-diol
