![3-(1H-Pyrrolo[2,3-b]pyridin-5-yl)-acrylic acid methyl ester (CAS: 945029-05-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678186.png "3-(1H-Pyrrolo[2,3-b]pyridin-5-yl)-acrylic acid methyl ester chemical structure")
3-(1H-Pyrrolo[2,3-b]pyridin-5-yl)-acrylic acid methyl ester
Catalog No: FT-0678186
CAS No: 945029-05-0
- Chemical Name: 3-(1H-Pyrrolo[2,3-b]pyridin-5-yl)-acrylic acid methyl ester
- Molecular Formula: C11H10N2O2
- Molecular Weight: 202.21
- InChI Key: SWDITGRTPKJPDC-NSCUHMNNSA-N
- InChI: InChI=1S/C11H10N2O2/c1-15-10(14)3-2-8-6-9-4-5-12-11(9)13-7-8/h2-7H,1H3,(H,12,13)/b3-2+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | methyl (E)-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enoate |
|---|---|
| Flash_Point: | N/A |
| Melting_Point: | 192-193ºC |
| FW: | 202.20900 |
| Density: | 1.295g/cm3 |
| CAS: | 945029-05-0 |
| Bolling_Point: | N/A |
| MF: | C11H10N2O2 |
| Melting_Point: | 192-193ºC |
|---|---|
| Density: | 1.295g/cm3 |
| LogP: | 1.74910 |
| Refractive_Index: | 1.679 |
| FW: | 202.20900 |
| PSA: | 54.98000 |
| MF: | C11H10N2O2 |
| Exact_Mass: | 202.07400 |
| Hazard_Codes: | Xi |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
