![1-(1H-Pyrrolo[2,3-b]pyridin-5-yl)-ethanone (CAS: 944937-14-8) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678340.png "1-(1H-Pyrrolo[2,3-b]pyridin-5-yl)-ethanone chemical structure")
1-(1H-Pyrrolo[2,3-b]pyridin-5-yl)-ethanone
Catalog No: FT-0678340
CAS No: 944937-14-8
- Chemical Name: 1-(1H-Pyrrolo[2,3-b]pyridin-5-yl)-ethanone
- Molecular Formula: C9H8N2O
- Molecular Weight: 160.17
- InChI Key: NKVUYPVQGPCIJO-UHFFFAOYSA-N
- InChI: InChI=1S/C9H8N2O/c1-6(12)8-4-7-2-3-10-9(7)11-5-8/h2-5H,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 160.17300 |
| Density: | 1.264g/cm3 |
| CAS: | 944937-14-8 |
| Bolling_Point: | N/A |
| Product_Name: | 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethanone |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C9H8N2O |
| Density: | 1.264g/cm3 |
|---|---|
| LogP: | 1.76550 |
| Refractive_Index: | 1.658 |
| FW: | 160.17300 |
| PSA: | 45.75000 |
| MF: | C9H8N2O |
| Exact_Mass: | 160.06400 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
