![6-bromofuro[3,2-b]pyridine (CAS: 934330-61-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0721494.png "6-bromofuro[3,2-b]pyridine chemical structure")
6-bromofuro[3,2-b]pyridine
Catalog No: FT-0721494
CAS No: 934330-61-7
- Chemical Name: 6-bromofuro[3,2-b]pyridine
- Molecular Formula: C7H4BrNO
- Molecular Weight: 198.02
- InChI Key: JGFXSVJDCAIQJE-UHFFFAOYSA-N
- InChI: InChI=1S/C7H4BrNO/c8-5-3-7-6(9-4-5)1-2-10-7/h1-4H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 934330-61-7 |
|---|---|
| MF: | C7H4BrNO |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 6-Bromofuro[3,2-b]pyridine |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 198.01700 |
| Exact_Mass: | 196.94800 |
|---|---|
| MF: | C7H4BrNO |
| LogP: | 2.59030 |
| PSA: | 26.03000 |
| FW: | 198.01700 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
