![[3-(1-pyrrolidinylmethyl)phenyl]methanamine (CAS: 91271-80-6) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0694243.png "[3-(1-pyrrolidinylmethyl)phenyl]methanamine chemical structure")
[3-(1-pyrrolidinylmethyl)phenyl]methanamine
Catalog No: FT-0694243
CAS No: 91271-80-6
- Chemical Name: [3-(1-pyrrolidinylmethyl)phenyl]methanamine
- Molecular Formula: C13H20N2
- Molecular Weight: 204.31
- InChI Key: BMNFPARGJHNMAX-UHFFFAOYSA-N
- InChI: InChI=1S/C13H20N2/c14-10-12-5-4-6-13(9-12)11-15-7-2-1-3-8-15/h4-6,9H,1-3,7-8,10-11,14H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | [3-(piperidin-1-ylmethyl)phenyl]methanamine |
|---|---|
| Flash_Point: | 131ºC |
| Melting_Point: | N/A |
| FW: | 204.31100 |
| Density: | 1.043g/cm3 |
| CAS: | 91271-80-6 |
| Bolling_Point: | 313.2ºC at 760mmHg |
| MF: | C13H20N2 |
| Density: | 1.043g/cm3 |
|---|---|
| LogP: | 2.76940 |
| Flash_Point: | 131ºC |
| Refractive_Index: | 1.57 |
| FW: | 204.31100 |
| PSA: | 29.26000 |
| MF: | C13H20N2 |
| Bolling_Point: | 313.2ºC at 760mmHg |
| Exact_Mass: | 204.16300 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Risk_Statements(EU): | 36/37/38 |
| HS_Code: | 2933399090 |
| Safety_Statements: | 26-36/37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)