1-chloro-3,5-dimethoxy-2-nitrobenzene
Catalog No: FT-0613058
CAS No: 90-25-5
- Chemical Name: 1-chloro-3,5-dimethoxy-2-nitrobenzene
- Molecular Formula: C8H8ClNO4
- Molecular Weight: 217.6
- InChI Key: VHLPIOGWYXZJJT-UHFFFAOYSA-N
- InChI: InChI=1S/C8H8ClNO4/c1-13-5-3-6(9)8(10(11)12)7(4-5)14-2/h3-4H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 158.5ºC |
|---|---|
| CAS: | 90-25-5 |
| MF: | C9H9N |
| Flash_Point: | 166.8ºC |
| Product_Name: | 5-Chlor-4-nitro-resorcin-dimethylaether |
| Density: | 1.349g/cm3 |
| FW: | 131.17400 |
| Bolling_Point: | 352.2ºC at 760 mmHg |
| Melting_Point: | 158.5ºC |
|---|---|
| Refractive_Index: | 1.545 |
| MF: | C9H9N |
| Flash_Point: | 166.8ºC |
| LogP: | 2.47630 |
| FW: | 131.17400 |
| Density: | 1.349g/cm3 |
| PSA: | 15.79000 |
| Bolling_Point: | 352.2ºC at 760 mmHg |
| Exact_Mass: | 131.07300 |