![Methyl 4'-chloro[1,1'-biphenyl]-4-carboxylate (CAS: 89901-02-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0680240.png "Methyl 4'-chloro[1,1'-biphenyl]-4-carboxylate chemical structure")
Methyl 4'-chloro[1,1'-biphenyl]-4-carboxylate
Catalog No: FT-0680240
CAS No: 89901-02-0
- Chemical Name: Methyl 4'-chloro[1,1'-biphenyl]-4-carboxylate
- Molecular Formula: C14H11ClO2
- Molecular Weight: 246.69
- InChI Key: UJIUMBFXWGXMOV-UHFFFAOYSA-N
- InChI: InChI=1S/C14H11ClO2/c1-17-14(16)12-4-2-10(3-5-12)11-6-8-13(15)9-7-11/h2-9H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS09 |
|---|---|
| CAS: | 89901-02-0 |
| Flash_Point: | 187.5ºC |
| Product_Name: | methyl 4-(4-chlorophenyl)benzoate |
| Bolling_Point: | 364.1ºC at 760 mmHg |
| FW: | 246.68900 |
| Melting_Point: | 113-115ºC |
| MF: | C14H11ClO2 |
| Density: | 1.205g/cm3 |
| Melting_Point: | 113-115ºC |
|---|---|
| Refractive_Index: | 1.574 |
| MF: | C14H11ClO2 |
| Flash_Point: | 187.5ºC |
| LogP: | 3.79360 |
| FW: | 246.68900 |
| Density: | 1.205g/cm3 |
| PSA: | 26.30000 |
| Bolling_Point: | 364.1ºC at 760 mmHg |
| Exact_Mass: | 246.04500 |
| Symbol: | GHS09 |
|---|---|
| HS_Code: | 2916399090 |
| RIDADR: | UN 3077 9 / PGIII |
| Warning_Statement: | P273-P501 |
| Safety_Statements: | H410 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)