![N-methyl-1-[4-(oxan-4-yloxy)phenyl]methanamine (CAS: 898289-40-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0763679.png "N-methyl-1-[4-(oxan-4-yloxy)phenyl]methanamine chemical structure")
N-methyl-1-[4-(oxan-4-yloxy)phenyl]methanamine
Catalog No: FT-0763679
CAS No: 898289-40-2
- Chemical Name: N-methyl-1-[4-(oxan-4-yloxy)phenyl]methanamine
- Molecular Formula: C13H19NO2
- Molecular Weight: 221.29
- InChI Key: BIMJTFGNKMMZOM-UHFFFAOYSA-N
- InChI: InChI=1S/C13H19NO2/c1-14-10-11-2-4-12(5-3-11)16-13-6-8-15-9-7-13/h2-5,13-14H,6-10H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 170/0.3mm |
|---|---|
| CAS: | 898289-40-2 |
| MF: | C13H19NO2 |
| Density: | 1.06g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | N-methyl-1-[4-(oxan-4-yloxy)phenyl]methanamine |
| Flash_Point: | 138.5ºC |
| FW: | 221.29500 |
| Density: | 1.06g/cm3 |
|---|---|
| MF: | C13H19NO2 |
| LogP: | 2.35470 |
| Exact_Mass: | 221.14200 |
| Bolling_Point: | 170/0.3mm |
| Flash_Point: | 138.5ºC |
| FW: | 221.29500 |
| Refractive_Index: | 1.526 |
| PSA: | 30.49000 |
| Hazard_Codes: | C: Corrosive; |
|---|---|
| HS_Code: | 2932999099 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)