2-IODO-4-NITROPHENOL
Catalog No: FT-0642126
CAS No: 89487-91-2
- Chemical Name: 2-IODO-4-NITROPHENOL
- Molecular Formula: C6H4INO3
- Molecular Weight: 265.01
- InChI Key: BKQFOYCEUMVWOW-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4INO3/c7-5-3-4(8(10)11)1-2-6(5)9/h1-3,9H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 265.00500 |
|---|---|
| CAS: | 89487-91-2 |
| Flash_Point: | 131.9ºC |
| MF: | C6H4INO3 |
| Symbol: | Warning |
| Bolling_Point: | 294.5ºC at 760 mmHg |
| Melting_Point: | N/A |
| Product_Name: | 2-Iodo-4-nitrophenol |
| Density: | 2.176 g/cm3 |
| FW: | 265.00500 |
|---|---|
| MF: | C6H4INO3 |
| Exact_Mass: | 264.92400 |
| Bolling_Point: | 294.5ºC at 760 mmHg |
| Refractive_Index: | 1.71 |
| PSA: | 66.05000 |
| LogP: | 2.42820 |
| Flash_Point: | 131.9ºC |
| Density: | 2.176 g/cm3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| HS_Code: | 2908999090 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)