1-(5-Bromo-2-chloropyridin-3-yl)ethanone
Catalog No: FT-0681666
CAS No: 886365-47-5
- Chemical Name: 1-(5-Bromo-2-chloropyridin-3-yl)ethanone
- Molecular Formula: C7H5BrClNO
- Molecular Weight: 234.48
- InChI Key: SQKOULMBBLJIKX-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5BrClNO/c1-4(11)6-2-5(8)3-10-7(6)9/h2-3H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 234.47800 |
| Density: | N/A |
| CAS: | 886365-47-5 |
| Bolling_Point: | N/A |
| Product_Name: | 1-(5-Bromo-2-chloropyridin-3-yl)ethanone |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C7H5BrClNO |
| LogP: | 2.70010 |
|---|---|
| PSA: | 29.96000 |
| MF: | C7H5BrClNO |
| FW: | 234.47800 |
| Exact_Mass: | 232.92400 |
| Warning_Statement: | P280-P301 + P312 + P330-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
|---|---|
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)