1-(1-Ethyl-1H-indol-3-yl)ethanone
Catalog No: FT-0684107
CAS No: 88636-52-6
- Chemical Name: 1-(1-Ethyl-1H-indol-3-yl)ethanone
- Molecular Formula: C12H13NO
- Molecular Weight: 187.24
- InChI Key: NLPARJNLWJDXMB-UHFFFAOYSA-N
- InChI: InChI=1S/C12H13NO/c1-3-13-8-11(9(2)14)10-6-4-5-7-12(10)13/h4-8H,3H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 187.23800 |
| Density: | 1.06g/cm3 |
| CAS: | 88636-52-6 |
| Bolling_Point: | 331.1ºC at 760 mmHg |
| Product_Name: | 1-(1-ethylindol-3-yl)ethanone |
| Melting_Point: | N/A |
| Flash_Point: | 154ºC |
| MF: | C12H13NO |
| Density: | 1.06g/cm3 |
|---|---|
| LogP: | 2.86380 |
| Flash_Point: | 154ºC |
| Refractive_Index: | 1.567 |
| FW: | 187.23800 |
| PSA: | 22.00000 |
| MF: | C12H13NO |
| Bolling_Point: | 331.1ºC at 760 mmHg |
| Exact_Mass: | 187.10000 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)