3-Amino-5-bromo-2-fluoropyridine
Catalog No: FT-0648097
CAS No: 884495-22-1
- Chemical Name: 3-Amino-5-bromo-2-fluoropyridine
- Molecular Formula: C5H4BrFN2
- Molecular Weight: 191
- InChI Key: CLYOMCMDBNNGSM-UHFFFAOYSA-N
- InChI: InChI=1S/C5H4BrFN2/c6-3-1-4(8)5(7)9-2-3/h1-2H,8H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 191.001 |
| Density: | 1.8±0.1 g/cm3 |
| CAS: | 884495-22-1 |
| Bolling_Point: | 278.2±35.0 °C at 760 mmHg |
| Product_Name: | 3-Amino-5-bromo-2-fluoropyridine |
| Melting_Point: | 75-80ºC |
| Flash_Point: | 122.1±25.9 °C |
| MF: | C5H4BrFN2 |
| Density: | 1.8±0.1 g/cm3 |
|---|---|
| LogP: | 1.73 |
| Flash_Point: | 122.1±25.9 °C |
| Melting_Point: | 75-80ºC |
| FW: | 191.001 |
| PSA: | 38.91000 |
| Exact_Mass: | 189.954178 |
| MF: | C5H4BrFN2 |
| Bolling_Point: | 278.2±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Refractive_Index: | 1.605 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Risk_Statements(EU): | 22-36/37/38 |
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)