3-bromo-N-phenylaniline
Catalog No: FT-0761057
CAS No: 88280-58-4
- Chemical Name: 3-bromo-N-phenylaniline
- Molecular Formula: C12H10BrN
- Molecular Weight: 248.12
- InChI Key: IXTBFWCKFRFDOO-UHFFFAOYSA-N
- InChI: InChI=1S/C12H10BrN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 88280-58-4 |
|---|---|
| MF: | C12H10BrN |
| Density: | 1.435 g/mL at 25ºC(lit.) |
| Flash_Point: | >230 °F |
| Melting_Point: | N/A |
| Product_Name: | 3-bromo-N-phenylaniline |
| Symbol: | GHS05, GHS07, GHS09 |
| Bolling_Point: | 239-287ºC (DSC)(lit.) |
| FW: | 248.11800 |
| Density: | 1.435 g/mL at 25ºC(lit.) |
|---|---|
| MF: | C12H10BrN |
| LogP: | 4.26570 |
| Exact_Mass: | 247.00000 |
| Bolling_Point: | 239-287ºC (DSC)(lit.) |
| Flash_Point: | >230 °F |
| FW: | 248.11800 |
| Refractive_Index: | n20/D 1.6705(lit.) |
| PSA: | 12.03000 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Symbol: | GHS05, GHS07, GHS09 |
| Safety_Statements: | 26-36/37-60-61 |
| Warning_Statement: | P261-P273-P280-P305 + P351 + P338 |
| Hazard_Codes: | Xn: Harmful;N: Dangerous for the environment; |
| HS_Code: | 2921440000 |
| RIDADR: | UN 3082 9 / PGIII |
| Risk_Statements(EU): | 22-37/38-41-51/53 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)