![(5-methylimidazo[1,2-a]pyridin-2-yl)methanol (CAS: 872363-02-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0711484.webp "(5-methylimidazo[1,2-a]pyridin-2-yl)methanol chemical structure")
(5-methylimidazo[1,2-a]pyridin-2-yl)methanol
Catalog No: FT-0711484
CAS No: 872363-02-5
- Chemical Name: (5-methylimidazo[1,2-a]pyridin-2-yl)methanol
- Molecular Formula: C9H10N2O
- Molecular Weight: 162.19 g/mol
- InChI Key: BIUQSIPXUVGMHC-UHFFFAOYSA-N
- InChI: InChI=1S/C9H10N2O/c1-7-3-2-4-9-10-8(6-12)5-11(7)9/h2-5,12H,6H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 872363-02-5 |
|---|---|
| MF: | C9H10N2O |
| Density: | 1.22g/cm3 |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | (5-MethyliMidazo[1,2-a]pyridin-2-yl)Methanol |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 162.18800 |
| MF: | C9H10N2O |
|---|---|
| LogP: | 1.13500 |
| Exact_Mass: | 162.07900 |
| Density: | 1.22g/cm3 |
| FW: | 162.18800 |
| Refractive_Index: | 1.622 |
| PSA: | 37.53000 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H317 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P280 |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.webp "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.webp "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
