Ethyl 6-methoxy-2-methylquinoline-3-carboxylate
Catalog No: FT-0683912
CAS No: 86210-92-6
- Chemical Name: Ethyl 6-methoxy-2-methylquinoline-3-carboxylate
- Molecular Formula: C14H15NO3
- Molecular Weight: 245.27
- InChI Key: DOOZEQYEQPQCGX-UHFFFAOYSA-N
- InChI: InChI=1S/C14H15NO3/c1-4-18-14(16)12-8-10-7-11(17-3)5-6-13(10)15-9(12)2/h5-8H,4H2,1-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 245.27400 |
| Density: | 1.159g/cm3 |
| CAS: | 86210-92-6 |
| Bolling_Point: | 348ºC at 760 mmHg |
| Product_Name: | ethyl 6-methoxy-2-methylquinoline-3-carboxylate |
| Melting_Point: | N/A |
| Flash_Point: | 164.2ºC |
| MF: | C14H15NO3 |
| Density: | 1.159g/cm3 |
|---|---|
| LogP: | 2.72850 |
| Flash_Point: | 164.2ºC |
| Refractive_Index: | 1.577 |
| FW: | 245.27400 |
| PSA: | 48.42000 |
| MF: | C14H15NO3 |
| Bolling_Point: | 348ºC at 760 mmHg |
| Exact_Mass: | 245.10500 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933499090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)