Erdosteine
Catalog No: FT-0630929
CAS No: 84611-23-4
- Chemical Name: Erdosteine
- Molecular Formula: C8H11NO4S2
- Molecular Weight: 249.3
- InChI Key: QGFORSXNKQLDNO-UHFFFAOYSA-N
- InChI: InChI=1S/C8H11NO4S2/c10-6(3-14-4-7(11)12)9-5-1-2-15-8(5)13/h5H,1-4H2,(H,9,10)(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 84611-23-4 |
| Flash_Point: | 310.8±30.1 °C |
| Product_Name: | Erdosteine |
| Bolling_Point: | 590.4±50.0 °C at 760 mmHg |
| FW: | 249.307 |
| Melting_Point: | 156-160°C |
| MF: | C8H11NO4S2 |
| Density: | 1.5±0.1 g/cm3 |
| Refractive_Index: | 1.615 |
|---|---|
| Vapor_Pressure: | 0.0±3.6 mmHg at 25°C |
| Flash_Point: | 310.8±30.1 °C |
| LogP: | -0.32 |
| Bolling_Point: | 590.4±50.0 °C at 760 mmHg |
| FW: | 249.307 |
| PSA: | 134.07000 |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :2 ', '3. Hydrogen Bond Acceptor Count :6 ', '4. Rotatable Bond Count :5 ', '5. Isotope Atom Count :4 ', '6. TPSA 134 ', '7. Heavy Atom Count :15 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :282 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :1 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 156-160°C |
| MF: | C8H11NO4S2 |
| Exact_Mass: | 249.012955 |
| Molecular_Structure: | ['1 . Molar refractive index 3972 ', '2 . Molar volume 1180 ', '3 . Parachor (902K)3320 ', '4 . Surface tension 626 ', '5 . Polarizability 1574'] |
| Density: | 1.5±0.1 g/cm3 |
| More_Info: | ['1. Melting point(ºC)从 Ethanol 中得White 结晶,. Melting point106~108'] |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38:Irritating to eyes, respiratory system and skin . |
| HS_Code: | 2934999090 |
| WGK_Germany: | 3 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
| Warning_Statement: | P301 + P312 + P330 |