Ethanone,1-(1H-pyrrolo[2,3-b]pyridin-3-yl)-(9CI)
Catalog No: FT-0647593
CAS No: 83393-46-8
- Chemical Name: Ethanone,1-(1H-pyrrolo[2,3-b]pyridin-3-yl)-(9CI)
- Molecular Formula: C9H8N2O
- Molecular Weight: 160.17
- InChI Key: OGMZQWPOZWMDQS-UHFFFAOYSA-N
- InChI: InChI=1S/C9H8N2O/c1-6(12)8-5-11-9-7(8)3-2-4-10-9/h2-5H,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 160.173 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 83393-46-8 |
| Bolling_Point: | 351.2±22.0 °C at 760 mmHg |
| Product_Name: | 1-(1H-Pyrrolo[2,3-b]pyridin-3-yl)ethanone |
| Melting_Point: | N/A |
| Flash_Point: | 170.2±28.8 °C |
| MF: | C9H8N2O |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 1.72 |
| Flash_Point: | 170.2±28.8 °C |
| Refractive_Index: | 1.658 |
| FW: | 160.173 |
| PSA: | 45.75000 |
| MF: | C9H8N2O |
| Bolling_Point: | 351.2±22.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Exact_Mass: | 160.063660 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H317-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)